Products 1332873-10-5
CAS 1332873-10-5 is the registry number for Methyl 2-(1-((tert-butoxycarbonyl)amino)ethyl)thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazole-5-carboxylate (CAS 1332873-10-5) is a chemical compound with the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. IUPAC name: methyl 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazole-5-carboxylate. InChIKey: AIFLJRDMYDURNA-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | methyl 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazole-5-carboxylate |
| InChIKey | AIFLJRDMYDURNA-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(S1)C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)