CAS 1052649-77-0 appears in our catalog under these names: H-D-Dab(boc)-ome hydrochloride, 95%, H-D-Dab(Boc)-OMe*HCl, H-D-Dab(Boc)-OMe·HCl 95%, (R)-Methyl 2-amino-4-((tert-butoxycarbonyl)amino)butanoate hydrochloride, 97%, 97%, Methyl (R)-2-amino-4-((tert-butoxycarbonyl)amino)butanoate hydrochloride, 95%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 500mg.
Methyl (2R)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride (CAS 1052649-77-0) is a chemical compound with the molecular formula C10H21ClN2O4 and a molecular weight of 268.74 g/mol. IUPAC name: methyl (2R)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride. InChIKey: XETISTBVDHNRBD-OGFXRTJISA-N.
| Molecular formula | C10H21ClN2O4 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | methyl (2R)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride |
| InChIKey | XETISTBVDHNRBD-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)