CAS 1384268-52-3 is the registry number for (R)-Ethyl 2-amino-3-(boc-amino)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride (CAS 1384268-52-3) is a chemical compound with the molecular formula C10H21ClN2O4 and a molecular weight of 268.74 g/mol. IUPAC name: ethyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride. InChIKey: DWFYPCOYLXRJIM-OGFXRTJISA-N.
| Molecular formula | C10H21ClN2O4 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride |
| InChIKey | DWFYPCOYLXRJIM-OGFXRTJISA-N |
| SMILES | CCOC(=O)[C@@H](CNC(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)