Products 1803565-67-4
CAS 1803565-67-4 appears in our catalog under these names: 2-([(tert-Butoxy)carbonyl]amino)-3-(dimethylamino)propanoic acid hydrochloride, 95%, 2-{((tert-butoxy)carbonyl)amino}-3-(dimethylamino)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride (CAS 1803565-67-4) is a chemical compound with the molecular formula C10H21ClN2O4 and a molecular weight of 268.74 g/mol. IUPAC name: 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride. InChIKey: UQEMCUXEGFXXFT-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O4 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride |
| InChIKey | UQEMCUXEGFXXFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CN(C)C)C(=O)O.Cl |
Computed by PubChem (NCBI)