Products 105284-17-1
CAS 105284-17-1 is the registry number for Dihydrotetramethylrosamine. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-N,3-N,6-N,6-N-tetramethyl-9-phenyl-9H-xanthene-3,6-diamine (CAS 105284-17-1) is a chemical compound with the molecular formula C23H24N2O and a molecular weight of 344.4 g/mol. IUPAC name: 3-N,3-N,6-N,6-N-tetramethyl-9-phenyl-9H-xanthene-3,6-diamine. InChIKey: PALQHVVMLBWIDW-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 3-N,3-N,6-N,6-N-tetramethyl-9-phenyl-9H-xanthene-3,6-diamine |
| InChIKey | PALQHVVMLBWIDW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(C3=C(O2)C=C(C=C3)N(C)C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)