Products 384810-77-9
CAS 384810-77-9 is the registry number for (4-(Dimethylamino)phenyl)(4-(methyl(phenylmethyl)amino)phenyl)-methanone. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
[4-[benzyl(methyl)amino]phenyl]-[4-(dimethylamino)phenyl]methanone (CAS 384810-77-9) is a chemical compound with the molecular formula C23H24N2O and a molecular weight of 344.4 g/mol. IUPAC name: [4-[benzyl(methyl)amino]phenyl]-[4-(dimethylamino)phenyl]methanone. InChIKey: KTQHDYYZMKBPED-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | [4-[benzyl(methyl)amino]phenyl]-[4-(dimethylamino)phenyl]methanone |
| InChIKey | KTQHDYYZMKBPED-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N(C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)