CAS 195371-52-9 appears in our catalog under these names: 2-Methyl-1-phenyl-4-(pyridin-2-yl)-2-(2-(pyridin-2-yl)ethyl)butan-1-one, 95%, JAK2 Inhibitor V, JAK2 Inhibitor V, Z3, NSC 42834, 98%, 98%, NSC 42834, 96.85%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 500mg, 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso).
2-methyl-1-phenyl-4-pyridin-2-yl-2-(2-pyridin-2-ylethyl)butan-1-one (CAS 195371-52-9) is a chemical compound with the molecular formula C23H24N2O and a molecular weight of 344.4 g/mol. IUPAC name: 2-methyl-1-phenyl-4-pyridin-2-yl-2-(2-pyridin-2-ylethyl)butan-1-one. InChIKey: SETYDCSRABYHSW-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-methyl-1-phenyl-4-pyridin-2-yl-2-(2-pyridin-2-ylethyl)butan-1-one |
| InChIKey | SETYDCSRABYHSW-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=CC=N1)(CCC2=CC=CC=N2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)