Products 105337-37-9

CAS 105337-37-9 is the registry number for 4-(3-Methylbutyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(3-methylbutyl)benzoic acid (CAS 105337-37-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 4-(3-methylbutyl)benzoic acid. InChIKey: MSISUZOSLCCXLN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2
Molecular weight192.25 g/mol
IUPAC name4-(3-methylbutyl)benzoic acid
InChIKeyMSISUZOSLCCXLN-UHFFFAOYSA-N
SMILESCC(C)CCC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)