Products 105351-70-0
CAS 105351-70-0 is the registry number for Tanshinlactone. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,14-dimethyl-12,16-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),13-heptaen-17-one (CAS 105351-70-0) is a chemical compound with the molecular formula C17H12O3 and a molecular weight of 264.27 g/mol. IUPAC name: 6,14-dimethyl-12,16-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),13-heptaen-17-one. InChIKey: VDYMGLBSIBHGCP-UHFFFAOYSA-N.
| Molecular formula | C17H12O3 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | 6,14-dimethyl-12,16-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,11(15),13-heptaen-17-one |
| InChIKey | VDYMGLBSIBHGCP-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)C(=O)OC4=C3OC=C4C |
Computed by PubChem (NCBI)