Products 105356-56-7

CAS 105356-56-7 is the registry number for 2,4-Dioxo-4-(thiophen-3-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,4-dioxo-4-thiophen-3-ylbutanoic acid (CAS 105356-56-7) is a chemical compound with the molecular formula C8H6O4S and a molecular weight of 198.20 g/mol. IUPAC name: 2,4-dioxo-4-thiophen-3-ylbutanoic acid. InChIKey: XGDKWSCYRNCHSE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6O4S
Molecular weight198.20 g/mol
IUPAC name2,4-dioxo-4-thiophen-3-ylbutanoic acid
InChIKeyXGDKWSCYRNCHSE-UHFFFAOYSA-N
SMILESC1=CSC=C1C(=O)CC(=O)C(=O)O

Computed by PubChem (NCBI)