CAS 105356-56-7 is the registry number for 2,4-Dioxo-4-(thiophen-3-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-dioxo-4-thiophen-3-ylbutanoic acid (CAS 105356-56-7) is a chemical compound with the molecular formula C8H6O4S and a molecular weight of 198.20 g/mol. IUPAC name: 2,4-dioxo-4-thiophen-3-ylbutanoic acid. InChIKey: XGDKWSCYRNCHSE-UHFFFAOYSA-N.
| Molecular formula | C8H6O4S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 2,4-dioxo-4-thiophen-3-ylbutanoic acid |
| InChIKey | XGDKWSCYRNCHSE-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C(=O)CC(=O)C(=O)O |
Computed by PubChem (NCBI)