CAS 49670-47-5 appears in our catalog under these names: 2,2-Dioxo-1,2-benzoxanthin-4(3h)-one, 95%, 2,2-Dioxo-1,2-benzoxanthin-4(3h)-one, 4-hydroxy-1,2λâ¶-benzoxathiine-2,2-dione, 97%. Offered by: Combi-blocks, TRC, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g.
2,2-dioxo-1,2lambda6-benzoxathiin-4-one (CAS 49670-47-5) is a chemical compound with the molecular formula C8H6O4S and a molecular weight of 198.20 g/mol. IUPAC name: 2,2-dioxo-1,2lambda6-benzoxathiin-4-one. InChIKey: LWRIFZQUNPLIMF-UHFFFAOYSA-N.
| Molecular formula | C8H6O4S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 2,2-dioxo-1,2lambda6-benzoxathiin-4-one |
| InChIKey | LWRIFZQUNPLIMF-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC=CC=C2OS1(=O)=O |
Computed by PubChem (NCBI)