Products 82520-79-4
CAS 82520-79-4 is the registry number for 4-Mercaptophthalic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-sulfanylphthalic acid (CAS 82520-79-4) is a chemical compound with the molecular formula C8H6O4S and a molecular weight of 198.20 g/mol. IUPAC name: 4-sulfanylphthalic acid. InChIKey: FZUUAPPKEJXGEN-UHFFFAOYSA-N.
| Molecular formula | C8H6O4S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 4-sulfanylphthalic acid |
| InChIKey | FZUUAPPKEJXGEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)