CAS 105391-65-9 is the registry number for 5-(Difluoromethoxy)-1H-indazole, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
5-(difluoromethoxy)-1H-indazole (CAS 105391-65-9) is a chemical compound with the molecular formula C8H6F2N2O and a molecular weight of 184.14 g/mol. IUPAC name: 5-(difluoromethoxy)-1H-indazole. InChIKey: RAILRWBDHWNUFC-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 5-(difluoromethoxy)-1H-indazole |
| InChIKey | RAILRWBDHWNUFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)F)C=NN2 |
Computed by PubChem (NCBI)