CAS 1423029-59-7 appears in our catalog under these names: 6-(2,2-Difluoroethoxy)pyridine-2-carbonitrile, 95%, 6-(2,2-Difluoroethoxy)pyridine-2-carbonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg, 0,5g.
6-(2,2-difluoroethoxy)pyridine-2-carbonitrile (CAS 1423029-59-7) is a chemical compound with the molecular formula C8H6F2N2O and a molecular weight of 184.14 g/mol. IUPAC name: 6-(2,2-difluoroethoxy)pyridine-2-carbonitrile. InChIKey: SSYANEDKQYPCCD-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 6-(2,2-difluoroethoxy)pyridine-2-carbonitrile |
| InChIKey | SSYANEDKQYPCCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OCC(F)F)C#N |
Computed by PubChem (NCBI)