Products 813424-17-8
CAS 813424-17-8 appears in our catalog under these names: 5-Amino-3,3-difluoroindolin-2-one, 98%, 5-Amino-3,3-difluoro-2,3-dihydro-1H-indol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
5-amino-3,3-difluoro-1H-indol-2-one (CAS 813424-17-8) is a chemical compound with the molecular formula C8H6F2N2O and a molecular weight of 184.14 g/mol. IUPAC name: 5-amino-3,3-difluoro-1H-indol-2-one. InChIKey: HRWISVRCOFVMGR-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 5-amino-3,3-difluoro-1H-indol-2-one |
| InChIKey | HRWISVRCOFVMGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(C(=O)N2)(F)F |
Computed by PubChem (NCBI)