CAS 10540-31-5 appears in our catalog under these names: 4'-Fluoro-[1,1'-biphenyl]-4-carbonitrile 98%, 4'-Fluoro-[1,1'-biphenyl]-4-carbonitrile, 98%(GC-MS),RG. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-(4-fluorophenyl)benzonitrile (CAS 10540-31-5) is a chemical compound with the molecular formula C13H8FN and a molecular weight of 197.21 g/mol. IUPAC name: 4-(4-fluorophenyl)benzonitrile. InChIKey: URIGWZMDTRKUSJ-UHFFFAOYSA-N.
| Molecular formula | C13H8FN |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 4-(4-fluorophenyl)benzonitrile |
| InChIKey | URIGWZMDTRKUSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)