CAS 93129-69-2 appears in our catalog under these names: 4-Cyano-2-fluoro-biphenyl, ≥95%, 4-Cyano-2-fluoro-biphenyl, ≥95%, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
3-fluoro-4-phenylbenzonitrile (CAS 93129-69-2) is a chemical compound with the molecular formula C13H8FN and a molecular weight of 197.21 g/mol. IUPAC name: 3-fluoro-4-phenylbenzonitrile. InChIKey: IBMLGDKPIPQNME-UHFFFAOYSA-N.
| Molecular formula | C13H8FN |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 3-fluoro-4-phenylbenzonitrile |
| InChIKey | IBMLGDKPIPQNME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)C#N)F |
Computed by PubChem (NCBI)