CAS 1072206-95-1 is the registry number for 4-Fluoro[1,1′-biphenyl]-2-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-fluoro-2-phenylbenzonitrile (CAS 1072206-95-1) is a chemical compound with the molecular formula C13H8FN and a molecular weight of 197.21 g/mol. IUPAC name: 5-fluoro-2-phenylbenzonitrile. InChIKey: BOQONIFBINKSQD-UHFFFAOYSA-N.
| Molecular formula | C13H8FN |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 5-fluoro-2-phenylbenzonitrile |
| InChIKey | BOQONIFBINKSQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)F)C#N |
Computed by PubChem (NCBI)