CAS 105401-94-3 appears in our catalog under these names: Ethyl 4-methoxy-3,5-dimethylbenzoate, 95%, Ethyl 4-methoxy-3,5-dimethylbenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 4-methoxy-3,5-dimethylbenzoate (CAS 105401-94-3) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: ethyl 4-methoxy-3,5-dimethylbenzoate. InChIKey: VTPOFWHQBYJVTQ-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | ethyl 4-methoxy-3,5-dimethylbenzoate |
| InChIKey | VTPOFWHQBYJVTQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)OC)C |
Computed by PubChem (NCBI)