CAS 105404-89-5 appears in our catalog under these names: 2,7-Dibromo-3,6-dimethoxynaphthalene, 95%, 2,7-Dibromo-3,6-dimethoxynaphthalene, 98+%, 2,7-Dibromo-3,6-dimethoxynaphthalene, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2,7-dibromo-3,6-dimethoxynaphthalene (CAS 105404-89-5) is a chemical compound with the molecular formula C12H10Br2O2 and a molecular weight of 346.01 g/mol. IUPAC name: 2,7-dibromo-3,6-dimethoxynaphthalene. InChIKey: IXKYNFRCDWZQOX-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2O2 |
|---|---|
| Molecular weight | 346.01 g/mol |
| IUPAC name | 2,7-dibromo-3,6-dimethoxynaphthalene |
| InChIKey | IXKYNFRCDWZQOX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC(=C(C=C2C=C1Br)Br)OC |
Computed by PubChem (NCBI)