CAS 2648221-47-8 appears in our catalog under these names: 1,8-Dibromo-3-(methoxymethoxy)naphthalene, 98%, 1,8-Dibromo-3-(methoxymethoxy)naphthalene, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1,8-dibromo-3-(methoxymethoxy)naphthalene (CAS 2648221-47-8) is a chemical compound with the molecular formula C12H10Br2O2 and a molecular weight of 346.01 g/mol. IUPAC name: 1,8-dibromo-3-(methoxymethoxy)naphthalene. InChIKey: CJBLYOXFRKTWGY-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2O2 |
|---|---|
| Molecular weight | 346.01 g/mol |
| IUPAC name | 1,8-dibromo-3-(methoxymethoxy)naphthalene |
| InChIKey | CJBLYOXFRKTWGY-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C2C(=C1)C=CC=C2Br)Br |
Computed by PubChem (NCBI)