CAS 25315-06-4 is the registry number for 1,5-Dibromo-2,6-dimethoxynaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,5-dibromo-2,6-dimethoxynaphthalene (CAS 25315-06-4) is a chemical compound with the molecular formula C12H10Br2O2 and a molecular weight of 346.01 g/mol. IUPAC name: 1,5-dibromo-2,6-dimethoxynaphthalene. InChIKey: ISDSFEXTWVVJKX-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2O2 |
|---|---|
| Molecular weight | 346.01 g/mol |
| IUPAC name | 1,5-dibromo-2,6-dimethoxynaphthalene |
| InChIKey | ISDSFEXTWVVJKX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=C(C=C2)OC)Br)Br |
Computed by PubChem (NCBI)