Products 1054105-48-4
CAS 1054105-48-4 appears in our catalog under these names: 2-{2-((4-Fluorophenyl)methoxy)phenoxy}acetic acid, 2-{2-((4-fluorophenyl)methoxy)phenoxy}acetic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-[2-[(4-fluorophenyl)methoxy]phenoxy]acetic acid (CAS 1054105-48-4) is a chemical compound with the molecular formula C15H13FO4 and a molecular weight of 276.26 g/mol. IUPAC name: 2-[2-[(4-fluorophenyl)methoxy]phenoxy]acetic acid. InChIKey: YPIWCQPCXPZDCK-UHFFFAOYSA-N.
| Molecular formula | C15H13FO4 |
|---|---|
| Molecular weight | 276.26 g/mol |
| IUPAC name | 2-[2-[(4-fluorophenyl)methoxy]phenoxy]acetic acid |
| InChIKey | YPIWCQPCXPZDCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC=C(C=C2)F)OCC(=O)O |
Computed by PubChem (NCBI)