Products 915908-79-1

CAS 915908-79-1 is the registry number for 4-((2-Fluorobenzyl)oxy)-3-methoxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(2-fluorophenyl)methoxy]-3-methoxybenzoic acid (CAS 915908-79-1) is a chemical compound with the molecular formula C15H13FO4 and a molecular weight of 276.26 g/mol. IUPAC name: 4-[(2-fluorophenyl)methoxy]-3-methoxybenzoic acid. InChIKey: XWQXUUJFXKALNA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13FO4
Molecular weight276.26 g/mol
IUPAC name4-[(2-fluorophenyl)methoxy]-3-methoxybenzoic acid
InChIKeyXWQXUUJFXKALNA-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(=O)O)OCC2=CC=CC=C2F

Computed by PubChem (NCBI)