Products 540463-58-9
CAS 540463-58-9 is the registry number for 3-(Benzyloxy)-2-fluoro-6-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-fluoro-6-methoxy-3-phenylmethoxybenzoic acid (CAS 540463-58-9) is a chemical compound with the molecular formula C15H13FO4 and a molecular weight of 276.26 g/mol. IUPAC name: 2-fluoro-6-methoxy-3-phenylmethoxybenzoic acid. InChIKey: VCRZUAFQVHBCBM-UHFFFAOYSA-N.
| Molecular formula | C15H13FO4 |
|---|---|
| Molecular weight | 276.26 g/mol |
| IUPAC name | 2-fluoro-6-methoxy-3-phenylmethoxybenzoic acid |
| InChIKey | VCRZUAFQVHBCBM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OCC2=CC=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)