CAS 1054479-09-2 is the registry number for 2-(3-(4-Bromophenyl)propyl)isoindoline-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[3-(4-bromophenyl)propyl]isoindole-1,3-dione (CAS 1054479-09-2) is a chemical compound with the molecular formula C17H14BrNO2 and a molecular weight of 344.2 g/mol. IUPAC name: 2-[3-(4-bromophenyl)propyl]isoindole-1,3-dione. InChIKey: BDAMLGMOHNVTAH-UHFFFAOYSA-N.
| Molecular formula | C17H14BrNO2 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | 2-[3-(4-bromophenyl)propyl]isoindole-1,3-dione |
| InChIKey | BDAMLGMOHNVTAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)