CAS 1404431-45-3 is the registry number for 5–Bromo–1–(4–methoxybenzyl)quinolin–2(1H)–one. Offered by: GLPBio. Available pack sizes: 100mg.
5-bromo-1-[(4-methoxyphenyl)methyl]quinolin-2-one (CAS 1404431-45-3) is a chemical compound with the molecular formula C17H14BrNO2 and a molecular weight of 344.2 g/mol. IUPAC name: 5-bromo-1-[(4-methoxyphenyl)methyl]quinolin-2-one. InChIKey: YBACRFASCQUNML-UHFFFAOYSA-N.
| Molecular formula | C17H14BrNO2 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | 5-bromo-1-[(4-methoxyphenyl)methyl]quinolin-2-one |
| InChIKey | YBACRFASCQUNML-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=C(C=CC2=O)C(=CC=C3)Br |
Computed by PubChem (NCBI)