CAS 897374-61-7 is the registry number for 6-Bromo-1-(4-methoxybenzyl)quinolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-bromo-1-[(4-methoxyphenyl)methyl]quinolin-2-one (CAS 897374-61-7) is a chemical compound with the molecular formula C17H14BrNO2 and a molecular weight of 344.2 g/mol. IUPAC name: 6-bromo-1-[(4-methoxyphenyl)methyl]quinolin-2-one. InChIKey: LBXRCDQFPJSLLO-UHFFFAOYSA-N.
| Molecular formula | C17H14BrNO2 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | 6-bromo-1-[(4-methoxyphenyl)methyl]quinolin-2-one |
| InChIKey | LBXRCDQFPJSLLO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=C(C=CC2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)