Products 1054506-59-0

CAS 1054506-59-0 is the registry number for p53-MDM2-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[4-[[(2-anilinoacetyl)hydrazinylidene]methyl]phenoxy]acetic acid (CAS 1054506-59-0) is a chemical compound with the molecular formula C17H17N3O4 and a molecular weight of 327.33 g/mol. IUPAC name: 2-[4-[[(2-anilinoacetyl)hydrazinylidene]methyl]phenoxy]acetic acid. InChIKey: NUKYHQOCKRPJKB-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17N3O4
Molecular weight327.33 g/mol
IUPAC name2-[4-[[(2-anilinoacetyl)hydrazinylidene]methyl]phenoxy]acetic acid
InChIKeyNUKYHQOCKRPJKB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NCC(=O)NN=CC2=CC=C(C=C2)OCC(=O)O

Computed by PubChem (NCBI)

Synonyms: orb2665170