CAS 17682-83-6 appears in our catalog under these names: Ac-Phe-pNA, Ac–Phe–pNA. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g.
(2S)-2-acetamido-N-(4-nitrophenyl)-3-phenylpropanamide (CAS 17682-83-6) is a chemical compound with the molecular formula C17H17N3O4 and a molecular weight of 327.33 g/mol. IUPAC name: (2S)-2-acetamido-N-(4-nitrophenyl)-3-phenylpropanamide. InChIKey: TZLBBSYDVWOTKB-INIZCTEOSA-N.
| Molecular formula | C17H17N3O4 |
|---|---|
| Molecular weight | 327.33 g/mol |
| IUPAC name | (2S)-2-acetamido-N-(4-nitrophenyl)-3-phenylpropanamide |
| InChIKey | TZLBBSYDVWOTKB-INIZCTEOSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)