CAS 1918982-87-2 is the registry number for 2-(4-(Benzyloxy)-3-methoxy-2-nitrophenyl)-4,5-dihydro-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-methoxy-2-nitro-4-phenylmethoxyphenyl)-4,5-dihydro-1H-imidazole (CAS 1918982-87-2) is a chemical compound with the molecular formula C17H17N3O4 and a molecular weight of 327.33 g/mol. IUPAC name: 2-(3-methoxy-2-nitro-4-phenylmethoxyphenyl)-4,5-dihydro-1H-imidazole. InChIKey: VPJPKCUUKRIRAQ-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O4 |
|---|---|
| Molecular weight | 327.33 g/mol |
| IUPAC name | 2-(3-methoxy-2-nitro-4-phenylmethoxyphenyl)-4,5-dihydro-1H-imidazole |
| InChIKey | VPJPKCUUKRIRAQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1[N+](=O)[O-])C2=NCCN2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)