CAS 10548-61-5 is the registry number for Benzyl b-D-xylopyranoside. Offered by: Biosynth. Available pack sizes: 25g, 10g.
(2R,3R,4S,5R)-2-phenylmethoxyoxane-3,4,5-triol (CAS 10548-61-5) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: (2R,3R,4S,5R)-2-phenylmethoxyoxane-3,4,5-triol. InChIKey: XUGMDBJXWCFLRQ-WRWGMCAJSA-N.
| Molecular formula | C12H16O5 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-phenylmethoxyoxane-3,4,5-triol |
| InChIKey | XUGMDBJXWCFLRQ-WRWGMCAJSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H](O1)OCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)