Products 2113984-36-2

CAS 2113984-36-2 is the registry number for Methyl 2,5-dimethoxy-4-(methoxymethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2,5-dimethoxy-4-(methoxymethyl)benzoate (CAS 2113984-36-2) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: methyl 2,5-dimethoxy-4-(methoxymethyl)benzoate. InChIKey: VUXCYIGMNFBCHI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O5
Molecular weight240.25 g/mol
IUPAC namemethyl 2,5-dimethoxy-4-(methoxymethyl)benzoate
InChIKeyVUXCYIGMNFBCHI-UHFFFAOYSA-N
SMILESCOCC1=CC(=C(C=C1OC)C(=O)OC)OC

Computed by PubChem (NCBI)