CAS 18403-12-8 appears in our catalog under these names: Benzyl alpha-d-xylopyranoside, 95%, Benzyl–a–D–xylopyranoside. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g.
(2S,3R,4S,5R)-2-phenylmethoxyoxane-3,4,5-triol (CAS 18403-12-8) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: (2S,3R,4S,5R)-2-phenylmethoxyoxane-3,4,5-triol. InChIKey: XUGMDBJXWCFLRQ-KXNHARMFSA-N.
| Molecular formula | C12H16O5 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-phenylmethoxyoxane-3,4,5-triol |
| InChIKey | XUGMDBJXWCFLRQ-KXNHARMFSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@H](O1)OCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)