CAS 105512-82-1 appears in our catalog under these names: 4-(4-Phenoxy-phenyl)-thiazol-2-ylamine, 95%, 4-(4-Phenoxyphenyl)-1,3-thiazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 10000mg.
4-(4-phenoxyphenyl)-1,3-thiazol-2-amine (CAS 105512-82-1) is a chemical compound with the molecular formula C15H12N2OS and a molecular weight of 268.3 g/mol. IUPAC name: 4-(4-phenoxyphenyl)-1,3-thiazol-2-amine. InChIKey: AZZJNMYKYSAYPZ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2OS |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 4-(4-phenoxyphenyl)-1,3-thiazol-2-amine |
| InChIKey | AZZJNMYKYSAYPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)