CAS 21083-47-6 appears in our catalog under these names: 5,5-Diphenyl-2-thiohydantoin, 95%, Phenytoin Impurity 2, 5,5-Diphenyl-2-thiohydantoin. Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 5g, on request, 10g.
5,5-diphenyl-2-sulfanylideneimidazolidin-4-one (CAS 21083-47-6) is a chemical compound with the molecular formula C15H12N2OS and a molecular weight of 268.3 g/mol. IUPAC name: 5,5-diphenyl-2-sulfanylideneimidazolidin-4-one. InChIKey: AMDPNECWKZZEBQ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2OS |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 5,5-diphenyl-2-sulfanylideneimidazolidin-4-one |
| InChIKey | AMDPNECWKZZEBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)NC(=S)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)