CAS 790-04-5 is the registry number for (2E)-3-Phenyl-2-(phenylimino)-1,3-thiazolidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (CAS 790-04-5) is a chemical compound with the molecular formula C15H12N2OS and a molecular weight of 268.3 g/mol. IUPAC name: 3-phenyl-2-phenylimino-1,3-thiazolidin-4-one. InChIKey: RAVFWIXHMXTJQU-UHFFFAOYSA-N.
| Molecular formula | C15H12N2OS |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| InChIKey | RAVFWIXHMXTJQU-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=NC2=CC=CC=C2)S1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)