CAS 105612-58-6 appears in our catalog under these names: Doxorubicin Impurity 14, Doxorubicin Impurity 15, 6,11-Dihydroxy-8-(2-hydroxyacetyl)-1-methoxytetracene-5,12-dione, 97%, 6,11-Dihydroxy-8-(2-hydroxyacetyl)-1-methoxytetracene-5,12-dione (Technical Grade). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 2,5mg.
6,11-dihydroxy-8-(2-hydroxyacetyl)-1-methoxytetracene-5,12-dione (CAS 105612-58-6) is a chemical compound with the molecular formula C21H14O7 and a molecular weight of 378.3 g/mol. IUPAC name: 6,11-dihydroxy-8-(2-hydroxyacetyl)-1-methoxytetracene-5,12-dione. InChIKey: HNDYQVGJPCBKHE-UHFFFAOYSA-N.
| Molecular formula | C21H14O7 |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | 6,11-dihydroxy-8-(2-hydroxyacetyl)-1-methoxytetracene-5,12-dione |
| InChIKey | HNDYQVGJPCBKHE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)C3=C(C4=C(C=C(C=C4)C(=O)CO)C(=C3C2=O)O)O |
Computed by PubChem (NCBI)