CAS 71809-95-5 is the registry number for Methyl Bis-anhydro-Daunomycinone Carboxylate. Offered by: TRC. Available pack sizes: 0,5mg, 1mg, 2,5mg.
Methyl 5,12-dihydroxy-7-methoxy-6,11-dioxotetracene-2-carboxylate (CAS 71809-95-5) is a chemical compound with the molecular formula C21H14O7 and a molecular weight of 378.3 g/mol. IUPAC name: methyl 5,12-dihydroxy-7-methoxy-6,11-dioxotetracene-2-carboxylate. InChIKey: MRCHBMFPTVPJHE-UHFFFAOYSA-N.
| Molecular formula | C21H14O7 |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | methyl 5,12-dihydroxy-7-methoxy-6,11-dioxotetracene-2-carboxylate |
| InChIKey | MRCHBMFPTVPJHE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)C3=C(C4=C(C=C(C=C4)C(=O)OC)C(=C3C2=O)O)O |
Computed by PubChem (NCBI)