CAS 20982-41-6 appears in our catalog under these names: Daunorubicin Impurity 5 (Daunomycin), Doxorubicin Impurity 19, 8-Acetyl-6,10,11-trihydroxy-1-methoxy-5,12-naphthacenedione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
3-acetyl-1,6,11-trihydroxy-10-methoxytetracene-5,12-dione (CAS 20982-41-6) is a chemical compound with the molecular formula C21H14O7 and a molecular weight of 378.3 g/mol. IUPAC name: 3-acetyl-1,6,11-trihydroxy-10-methoxytetracene-5,12-dione. InChIKey: HKHNHEFBYGYLQM-UHFFFAOYSA-N.
| Molecular formula | C21H14O7 |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | 3-acetyl-1,6,11-trihydroxy-10-methoxytetracene-5,12-dione |
| InChIKey | HKHNHEFBYGYLQM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C(=C1)O)C(=O)C3=C(C4=C(C=CC=C4OC)C(=C3C2=O)O)O |
Computed by PubChem (NCBI)