Products 105622-85-3
CAS 105622-85-3 appears in our catalog under these names: Dazonone/ 99.67% (existing batch purity), Dazonone, 6-Chloro-3-methyl-3,5-dihydroimidazo[2,1-b]quinazolin-2(1H)-one. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
6-chloro-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (CAS 105622-85-3) is a chemical compound with the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. IUPAC name: 6-chloro-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one. InChIKey: BHZFZYLBVSWUMT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 6-chloro-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| InChIKey | BHZFZYLBVSWUMT-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=NC3=C(CN12)C(=CC=C3)Cl |
Computed by PubChem (NCBI)