Products 70018-51-8
CAS 70018-51-8 appears in our catalog under these names: Quazinone (Ro 13-6438), Quazinone, Quazinone, 99.7%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 500mg, 5mg, 10mg, 25mg, 10 mg, 5 mg.
(3R)-6-chloro-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (CAS 70018-51-8) is a chemical compound with the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. IUPAC name: (3R)-6-chloro-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one. InChIKey: BHZFZYLBVSWUMT-ZCFIWIBFSA-N.
| Molecular formula | C11H10ClN3O |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | (3R)-6-chloro-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| InChIKey | BHZFZYLBVSWUMT-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1C(=O)NC2=NC3=C(CN12)C(=CC=C3)Cl |
Computed by PubChem (NCBI)