Products 105626-87-7

CAS 105626-87-7 is the registry number for 4-([3-Chloro-5-(trifluoromethyl)pyridin-2-yl]oxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid (CAS 105626-87-7) is a chemical compound with the molecular formula C13H7ClF3NO3 and a molecular weight of 317.65 g/mol. IUPAC name: 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid. InChIKey: QVROWMICPJBKTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H7ClF3NO3
Molecular weight317.65 g/mol
IUPAC name4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid
InChIKeyQVROWMICPJBKTJ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OC2=C(C=C(C=N2)C(F)(F)F)Cl

Computed by PubChem (NCBI)