Products 500535-61-5
CAS 500535-61-5 is the registry number for 1-(3-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene (CAS 500535-61-5) is a chemical compound with the molecular formula C13H7ClF3NO3 and a molecular weight of 317.65 g/mol. IUPAC name: 1-(3-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene. InChIKey: NTCZHYYWEOLZQW-UHFFFAOYSA-N.
| Molecular formula | C13H7ClF3NO3 |
|---|---|
| Molecular weight | 317.65 g/mol |
| IUPAC name | 1-(3-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | NTCZHYYWEOLZQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)