CAS 42874-01-1 appears in our catalog under these names: 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene, Nitrofluorfen 10 µg/mL in Cyclohexane. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 750mg, 1ml.
2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene (CAS 42874-01-1) is a chemical compound with the molecular formula C13H7ClF3NO3 and a molecular weight of 317.65 g/mol. IUPAC name: 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene. InChIKey: ZGGSVBWJVIXBHV-UHFFFAOYSA-N.
| Molecular formula | C13H7ClF3NO3 |
|---|---|
| Molecular weight | 317.65 g/mol |
| IUPAC name | 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene |
| InChIKey | ZGGSVBWJVIXBHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=C(C=C(C=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)