CAS 105644-17-5 is the registry number for 1-Oxo Colterol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)ethanone (CAS 105644-17-5) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: 2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)ethanone. InChIKey: RNGOPMBKNLMANA-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)ethanone |
| InChIKey | RNGOPMBKNLMANA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)