CAS 105678-27-1 is the registry number for tert-Butyl N,N-diisopropylcarbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N,N-di(propan-2-yl)carbamate (CAS 105678-27-1) is a chemical compound with the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. IUPAC name: tert-butyl N,N-di(propan-2-yl)carbamate. InChIKey: HNURUDICJPOGGD-UHFFFAOYSA-N.
| Molecular formula | C11H23NO2 |
|---|---|
| Molecular weight | 201.31 g/mol |
| IUPAC name | tert-butyl N,N-di(propan-2-yl)carbamate |
| InChIKey | HNURUDICJPOGGD-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)