CAS 195310-75-9 is the registry number for tert-Butyl (S)-2-amino-4,4-dimethylpentanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2-amino-4,4-dimethylpentanoate (CAS 195310-75-9) is a chemical compound with the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4,4-dimethylpentanoate. InChIKey: PWHPXSQVDDWLMI-QMMMGPOBSA-N.
| Molecular formula | C11H23NO2 |
|---|---|
| Molecular weight | 201.31 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4,4-dimethylpentanoate |
| InChIKey | PWHPXSQVDDWLMI-QMMMGPOBSA-N |
| SMILES | CC(C)(C)C[C@@H](C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)