Products 1464089-92-6

CAS 1464089-92-6 is the registry number for Pregabalin Impurity 67. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Propan-2-yl 3-(aminomethyl)-5-methylhexanoate (CAS 1464089-92-6) is a chemical compound with the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. IUPAC name: propan-2-yl 3-(aminomethyl)-5-methylhexanoate. InChIKey: CJCOJSZDSHUKME-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23NO2
Molecular weight201.31 g/mol
IUPAC namepropan-2-yl 3-(aminomethyl)-5-methylhexanoate
InChIKeyCJCOJSZDSHUKME-UHFFFAOYSA-N
SMILESCC(C)CC(CC(=O)OC(C)C)CN

Computed by PubChem (NCBI)