CAS 1057279-05-6 is the registry number for 2-(4-Bromophenyl)-1,2,3,4-tetrahydroisoquinoline. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
2-(4-bromophenyl)-3,4-dihydro-1H-isoquinoline (CAS 1057279-05-6) is a chemical compound with the molecular formula C15H14BrN and a molecular weight of 288.18 g/mol. IUPAC name: 2-(4-bromophenyl)-3,4-dihydro-1H-isoquinoline. InChIKey: NCGNJJRGLWENIQ-UHFFFAOYSA-N.
| Molecular formula | C15H14BrN |
|---|---|
| Molecular weight | 288.18 g/mol |
| IUPAC name | 2-(4-bromophenyl)-3,4-dihydro-1H-isoquinoline |
| InChIKey | NCGNJJRGLWENIQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)